C15H14O3S2 — CID 64642953
2-(2,3-dihydro-1H-inden-5-ylsulfonyl)-1-thiophen-2-ylethanone (PubChem CID 64642953) has the molecular formula C15H14O3S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylsulfonyl)-1-thiophen-2-ylethanone.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylsulfonyl)-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 64642953 |
| Molecular Formula | C15H14O3S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylsulfonyl)-1-thiophen-2-ylethanone |
| SMILES | O=C(CS(=O)(=O)c1ccc2c(c1)CCC2)c1cccs1 |
| InChI | InChI=1S/C15H14O3S2/c16-14(15-5-2-8-19-15)10-20(17,18)13-7-6-11-3-1-4-12(11)9-13/h2,5-9H,1,3-4,10H2 |
| InChIKey | XJGFITNDZLYBQB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |