C19H20N2O3S — CID 9479209
N'-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]thiophene-2-carbohydrazide (PubChem CID 9479209) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is N'-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9479209 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N'-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)CCCC2)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C19H20N2O3S/c22-16(15-8-7-13-4-1-2-5-14(13)12-15)9-10-18(23)20-21-19(24)17-6-3-11-25-17/h3,6-8,11-12H,1-2,4-5,9-10H2,(H,20,23)(H,21,24) |
| InChIKey | OWCSZOVSUWQPDK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|