C17H23NO2 — CID 94282659
N-tert-butyl-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanamide (PubChem CID 94282659) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is N-tert-butyl-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanamide.
| Compound Name | N-tert-butyl-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 94282659 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N-tert-butyl-4-(2,3-dihydro-1H-inden-5-yl)-4-oxobutanamide |
| SMILES | CC(C)(C)NC(=O)CCC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H23NO2/c1-17(2,3)18-16(20)10-9-15(19)14-8-7-12-5-4-6-13(12)11-14/h7-8,11H,4-6,9-10H2,1-3H3,(H,18,20) |
| InChIKey | AMYSQQCLZHCZIC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |