C17H24N2O2 — CID 119505485
4-(2,3-dihydro-1H-inden-5-yl)-N-[2-(ethylamino)ethyl]-4-oxobutanamide (PubChem CID 119505485) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-yl)-N-[2-(ethylamino)ethyl]-4-oxobutanamide.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-yl)-N-[2-(ethylamino)ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 119505485 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-yl)-N-[2-(ethylamino)ethyl]-4-oxobutanamide |
| SMILES | CCNCCNC(=O)CCC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H24N2O2/c1-2-18-10-11-19-17(21)9-8-16(20)15-7-6-13-4-3-5-14(13)12-15/h6-7,12,18H,2-5,8-11H2,1H3,(H,19,21) |
| InChIKey | OQEQJJWCNTWHMR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|