C16H19NO2 — CID 78792080
4-(2,3-dihydro-1H-inden-5-yl)-4-oxo-N-prop-2-enylbutanamide (PubChem CID 78792080) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-yl)-4-oxo-N-prop-2-enylbutanamide.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-yl)-4-oxo-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 78792080 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-yl)-4-oxo-N-prop-2-enylbutanamide |
| SMILES | C=CCNC(=O)CCC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H19NO2/c1-2-10-17-16(19)9-8-15(18)14-7-6-12-4-3-5-13(12)11-14/h2,6-7,11H,1,3-5,8-10H2,(H,17,19) |
| InChIKey | JOIDBJFBMCKHKS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|