C15H19NO — CID 94260534
1-(2,3-dihydro-1H-inden-5-yl)-3-(prop-2-enylamino)propan-1-one (PubChem CID 94260534) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-3-(prop-2-enylamino)propan-1-one.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-(prop-2-enylamino)propan-1-one |
|---|---|
| PubChem CID | 94260534 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-(prop-2-enylamino)propan-1-one |
| SMILES | C=CCNCCC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H19NO/c1-2-9-16-10-8-15(17)14-7-6-12-4-3-5-13(12)11-14/h2,6-7,11,16H,1,3-5,8-10H2 |
| InChIKey | STVGQCAAAQPXHT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|