C21H22N2O3 — CID 9441784
4-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]amino]benzamide (PubChem CID 9441784) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]amino]benzamide.
| Compound Name | 4-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]amino]benzamide |
|---|---|
| PubChem CID | 9441784 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 4-[[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CCC(=O)c2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C21H22N2O3/c22-21(26)15-7-9-18(10-8-15)23-20(25)12-11-19(24)17-6-5-14-3-1-2-4-16(14)13-17/h5-10,13H,1-4,11-12H2,(H2,22,26)(H,23,25) |
| InChIKey | CIMPENIIKKTIPH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |