C20H19Cl2NO3 — CID 108807181
N-(3,5-dichloro-4-hydroxyphenyl)-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide (PubChem CID 108807181) has the molecular formula C20H19Cl2NO3 and a molecular weight of 392.28 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide |
|---|---|
| PubChem CID | 108807181 |
| Molecular Formula | C20H19Cl2NO3 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)CCCC2)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2NO3/c21-16-10-15(11-17(22)20(16)26)23-19(25)8-7-18(24)14-6-5-12-3-1-2-4-13(12)9-14/h5-6,9-11,26H,1-4,7-8H2,(H,23,25) |
| InChIKey | HNZNVKRKCWTFRY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|