C16H12Cl3NO3 — CID 108808181
4-(4-chlorophenyl)-N-(3,5-dichloro-4-hydroxyphenyl)-4-oxobutanamide (PubChem CID 108808181) has the molecular formula C16H12Cl3NO3 and a molecular weight of 372.64 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(3,5-dichloro-4-hydroxyphenyl)-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-(3,5-dichloro-4-hydroxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 108808181 |
| Molecular Formula | C16H12Cl3NO3 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(3,5-dichloro-4-hydroxyphenyl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)cc1)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl3NO3/c17-10-3-1-9(2-4-10)14(21)5-6-15(22)20-11-7-12(18)16(23)13(19)8-11/h1-4,7-8,23H,5-6H2,(H,20,22) |
| InChIKey | AMBUPIGDGYOWNN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|