C12H8Cl2O3S2 — CID 64643112
2-(2,5-dichlorophenyl)sulfonyl-1-thiophen-2-ylethanone (PubChem CID 64643112) has the molecular formula C12H8Cl2O3S2 and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfonyl-1-thiophen-2-ylethanone.
| Compound Name | 2-(2,5-dichlorophenyl)sulfonyl-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 64643112 |
| Molecular Formula | C12H8Cl2O3S2 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfonyl-1-thiophen-2-ylethanone |
| SMILES | O=C(CS(=O)(=O)c1cc(Cl)ccc1Cl)c1cccs1 |
| InChI | InChI=1S/C12H8Cl2O3S2/c13-8-3-4-9(14)12(6-8)19(16,17)7-10(15)11-2-1-5-18-11/h1-6H,7H2 |
| InChIKey | HIUALFHNOJURGC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |