C14H12Cl2O3S2 — CID 64643110
4-(2,5-dichlorophenyl)sulfonyl-1-thiophen-2-ylbutan-1-one (PubChem CID 64643110) has the molecular formula C14H12Cl2O3S2 and a molecular weight of 363.29 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)sulfonyl-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-(2,5-dichlorophenyl)sulfonyl-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 64643110 |
| Molecular Formula | C14H12Cl2O3S2 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 4-(2,5-dichlorophenyl)sulfonyl-1-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCS(=O)(=O)c1cc(Cl)ccc1Cl)c1cccs1 |
| InChI | InChI=1S/C14H12Cl2O3S2/c15-10-5-6-11(16)14(9-10)21(18,19)8-2-3-12(17)13-4-1-7-20-13/h1,4-7,9H,2-3,8H2 |
| InChIKey | RTKYSDBXVXNXLO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |