C14H10Cl2O2S — CID 126060994
1-(2,4-dichlorophenyl)-4-thiophen-2-ylbutane-1,4-dione (PubChem CID 126060994) has the molecular formula C14H10Cl2O2S and a molecular weight of 313.20 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-thiophen-2-ylbutane-1,4-dione.
| Compound Name | 1-(2,4-dichlorophenyl)-4-thiophen-2-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 126060994 |
| Molecular Formula | C14H10Cl2O2S |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-thiophen-2-ylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccc(Cl)cc1Cl)c1cccs1 |
| InChI | InChI=1S/C14H10Cl2O2S/c15-9-3-4-10(11(16)8-9)12(17)5-6-13(18)14-2-1-7-19-14/h1-4,7-8H,5-6H2 |
| InChIKey | SYFGOWCTMSHCQN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |