C14H12Cl2O2S2 — CID 64637636
4-(2,5-dichlorophenyl)sulfinyl-1-thiophen-2-ylbutan-1-one (PubChem CID 64637636) has the molecular formula C14H12Cl2O2S2 and a molecular weight of 347.29 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)sulfinyl-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-(2,5-dichlorophenyl)sulfinyl-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 64637636 |
| Molecular Formula | C14H12Cl2O2S2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 4-(2,5-dichlorophenyl)sulfinyl-1-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCS(=O)c1cc(Cl)ccc1Cl)c1cccs1 |
| InChI | InChI=1S/C14H12Cl2O2S2/c15-10-5-6-11(16)14(9-10)20(18)8-2-3-12(17)13-4-1-7-19-13/h1,4-7,9H,2-3,8H2 |
| InChIKey | CDKDYQJXWVGFNP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |