C11H15NO2S — CID 43796416
2-(3-methylmorpholin-4-yl)-1-thiophen-2-ylethanone (PubChem CID 43796416) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-(3-methylmorpholin-4-yl)-1-thiophen-2-ylethanone.
| Compound Name | 2-(3-methylmorpholin-4-yl)-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 43796416 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-(3-methylmorpholin-4-yl)-1-thiophen-2-ylethanone |
| SMILES | CC1COCCN1CC(=O)c1cccs1 |
| InChI | InChI=1S/C11H15NO2S/c1-9-8-14-5-4-12(9)7-10(13)11-3-2-6-15-11/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | BPRRPDHWJKMIRL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |