C14H23NO2SSi — CID 75478811
1-thiophen-2-yl-2-[4-(trimethylsilylmethyl)morpholin-3-yl]ethanone (PubChem CID 75478811) has the molecular formula C14H23NO2SSi and a molecular weight of 297.50 g/mol. Its IUPAC name is 1-thiophen-2-yl-2-[4-(trimethylsilylmethyl)morpholin-3-yl]ethanone.
| Compound Name | 1-thiophen-2-yl-2-[4-(trimethylsilylmethyl)morpholin-3-yl]ethanone |
|---|---|
| PubChem CID | 75478811 |
| Molecular Formula | C14H23NO2SSi |
| Molecular Weight | 297.50 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-thiophen-2-yl-2-[4-(trimethylsilylmethyl)morpholin-3-yl]ethanone |
| SMILES | C[Si](C)(C)CN1CCOCC1CC(=O)c1cccs1 |
| InChI | InChI=1S/C14H23NO2SSi/c1-19(2,3)11-15-6-7-17-10-12(15)9-13(16)14-5-4-8-18-14/h4-5,8,12H,6-7,9-11H2,1-3H3 |
| InChIKey | ZPAAPNWFTLSUQE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|