C18H21NO3S — CID 99578863
2-[(3S)-4-[[4-(hydroxymethyl)phenyl]methyl]morpholin-3-yl]-1-thiophen-2-ylethanone (PubChem CID 99578863) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-[(3S)-4-[[4-(hydroxymethyl)phenyl]methyl]morpholin-3-yl]-1-thiophen-2-ylethanone.
| Compound Name | 2-[(3S)-4-[[4-(hydroxymethyl)phenyl]methyl]morpholin-3-yl]-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 99578863 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-[(3S)-4-[[4-(hydroxymethyl)phenyl]methyl]morpholin-3-yl]-1-thiophen-2-ylethanone |
| SMILES | O=C(C[C@H]1COCCN1Cc1ccc(CO)cc1)c1cccs1 |
| InChI | InChI=1S/C18H21NO3S/c20-12-15-5-3-14(4-6-15)11-19-7-8-22-13-16(19)10-17(21)18-2-1-9-23-18/h1-6,9,16,20H,7-8,10-13H2/t16-/m0/s1 |
| InChIKey | PEFXAKLEBSIEHN-INIZCTEOSA-N |
| XLogP | 2.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |