C15H17F2N3O2S — CID 86796926
2-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]morpholin-3-yl]-1-thiophen-2-ylethanone (PubChem CID 86796926) has the molecular formula C15H17F2N3O2S and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]morpholin-3-yl]-1-thiophen-2-ylethanone.
| Compound Name | 2-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]morpholin-3-yl]-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 86796926 |
| Molecular Formula | C15H17F2N3O2S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]morpholin-3-yl]-1-thiophen-2-ylethanone |
| SMILES | O=C(CC1COCCN1Cc1nccn1C(F)F)c1cccs1 |
| InChI | InChI=1S/C15H17F2N3O2S/c16-15(17)20-4-3-18-14(20)9-19-5-6-22-10-11(19)8-12(21)13-2-1-7-23-13/h1-4,7,11,15H,5-6,8-10H2 |
| InChIKey | GYSWQZUVEHCEOP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |