C14H19ClO3S — CID 97326442
(2S,3S)-3-[3-(4-chlorophenyl)propylsulfonyl]-2-methyloxolane (PubChem CID 97326442) has the molecular formula C14H19ClO3S and a molecular weight of 302.82 g/mol. Its IUPAC name is (2S,3S)-3-[3-(4-chlorophenyl)propylsulfonyl]-2-methyloxolane.
| Compound Name | (2S,3S)-3-[3-(4-chlorophenyl)propylsulfonyl]-2-methyloxolane |
|---|---|
| PubChem CID | 97326442 |
| Molecular Formula | C14H19ClO3S |
| Molecular Weight | 302.82 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (2S,3S)-3-[3-(4-chlorophenyl)propylsulfonyl]-2-methyloxolane |
| SMILES | C[C@@H]1OCC[C@@H]1S(=O)(=O)CCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClO3S/c1-11-14(8-9-18-11)19(16,17)10-2-3-12-4-6-13(15)7-5-12/h4-7,11,14H,2-3,8-10H2,1H3/t11-,14-/m0/s1 |
| InChIKey | NJCOXEVCUZJIJC-FZMZJTMJSA-N |
| XLogP | 2.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.82 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |