C9H10ClO3S- — CID 23047341
3-(4-chlorophenyl)propane-1-sulfonate (PubChem CID 23047341) has the molecular formula C9H10ClO3S- and a molecular weight of 233.70 g/mol. Its IUPAC name is 3-(4-chlorophenyl)propane-1-sulfonate.
| Compound Name | 3-(4-chlorophenyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 23047341 |
| Molecular Formula | C9H10ClO3S- |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 3-(4-chlorophenyl)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H11ClO3S/c10-9-5-3-8(4-6-9)2-1-7-14(11,12)13/h3-6H,1-2,7H2,(H,11,12,13)/p-1 |
| InChIKey | JBWULTOMCDOCDD-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|