C15H25O4SSi- — CID 86632451
3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]propane-1-sulfonate (PubChem CID 86632451) has the molecular formula C15H25O4SSi- and a molecular weight of 329.51 g/mol. Its IUPAC name is 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]propane-1-sulfonate.
| Compound Name | 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 86632451 |
| Molecular Formula | C15H25O4SSi- |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]propane-1-sulfonate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CCCS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C15H26O4SSi/c1-15(2,3)21(4,5)19-14-10-8-13(9-11-14)7-6-12-20(16,17)18/h8-11H,6-7,12H2,1-5H3,(H,16,17,18)/p-1 |
| InChIKey | KQPHFKCOXWAAJO-UHFFFAOYSA-M |
| XLogP | 3.55 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|