About tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane
tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane (PubChem CID 142715301) has the molecular formula C24H44OSi
and a molecular weight of 376.70 g/mol. Its IUPAC name is tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane |
| PubChem CID | 142715301 |
| Molecular Formula | C24H44OSi |
| Molecular Weight | 376.70 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane |
| SMILES | CCC(C)(CCCC(C)C)CCc1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H44OSi/c1-10-24(7,18-11-12-20(2)3)19-17-21-13-15-22(16-14-21)25-26(8,9)23(4,5)6/h13-16,20H,10-12,17-19H2,1-9H3 |
| InChIKey | NBTYLQVPNMLDIZ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.70 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane (CID 142715301) is tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane is CCC(C)(CCCC(C)C)CCc1ccc(O[Si](C)(C)C(C)(C)C)cc1.
What is the InChIKey of tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane?
The InChIKey is NBTYLQVPNMLDIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44OSi/c1-10-24(7,18-11-12-20(2)3)19-17-21-13-15-22(16-14-21)25-26(8,9)23(4,5)6/h13-16,20H,10-12,17-19H2,1-9H3.
What are the key properties of tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane?
tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane has a molecular weight of 376.70 g/mol, XLogP of 8.25, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[4-(3-ethyl-3,7-dimethyloctyl)phenoxy]-dimethylsilane is sourced from PubChem (CID 142715301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).