C41H62O6Si2 — CID 71559573
(3S,7S)-1,9-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-hydroxy-7-[(4-methoxyphenyl)methoxy]nonan-5-one (PubChem CID 71559573) has the molecular formula C41H62O6Si2 and a molecular weight of 707.11 g/mol. Its IUPAC name is (3S,7S)-1,9-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-hydroxy-7-[(4-methoxyphenyl)methoxy]nonan-5-one.
| Compound Name | (3S,7S)-1,9-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-hydroxy-7-[(4-methoxyphenyl)methoxy]nonan-5-one |
|---|---|
| PubChem CID | 71559573 |
| Molecular Formula | C41H62O6Si2 |
| Molecular Weight | 707.11 g/mol |
| Exact Mass | 706.41 |
| IUPAC Name | (3S,7S)-1,9-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-hydroxy-7-[(4-methoxyphenyl)methoxy]nonan-5-one |
| SMILES | COc1ccc(CO[C@@H](CCc2ccc(O[Si](C)(C)C(C)(C)C)cc2)CC(=O)C[C@@H](O)CCc2ccc(O[Si](C)(C)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C41H62O6Si2/c1-40(2,3)48(8,9)46-37-23-13-31(14-24-37)12-20-34(42)28-35(43)29-39(45-30-33-18-21-36(44-7)22-19-33)27-17-32-15-25-38(26-16-32)47-49(10,11)41(4,5)6/h13-16,18-19,21-26,34,39,42H,12,17,20,27-30H2,1-11H3/t34-,39-/m0/s1 |
| InChIKey | WZGFOYDFWUFQLD-FPCLRPRSSA-N |
| XLogP | 10.32 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.11 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|