C19H32O6Si — CID 174782746
tert-butyl-dimethyl-(4-propylphenoxy)silane;2-hydroxybutanedioic acid (PubChem CID 174782746) has the molecular formula C19H32O6Si and a molecular weight of 384.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-(4-propylphenoxy)silane;2-hydroxybutanedioic acid.
| Compound Name | tert-butyl-dimethyl-(4-propylphenoxy)silane;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 174782746 |
| Molecular Formula | C19H32O6Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | tert-butyl-dimethyl-(4-propylphenoxy)silane;2-hydroxybutanedioic acid |
| SMILES | CCCc1ccc(O[Si](C)(C)C(C)(C)C)cc1.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C15H26OSi.C4H6O5/c1-7-8-13-9-11-14(12-10-13)16-17(5,6)15(2,3)4;5-2(4(8)9)1-3(6)7/h9-12H,7-8H2,1-6H3;2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | DNCCNLIHGZLSFS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|