C25H34O5Si — CID 18798712
7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-5-hydroxy-3-oxo-5-phenylheptanoic acid (PubChem CID 18798712) has the molecular formula C25H34O5Si and a molecular weight of 442.63 g/mol. Its IUPAC name is 7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-5-hydroxy-3-oxo-5-phenylheptanoic acid.
| Compound Name | 7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-5-hydroxy-3-oxo-5-phenylheptanoic acid |
|---|---|
| PubChem CID | 18798712 |
| Molecular Formula | C25H34O5Si |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 7-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-5-hydroxy-3-oxo-5-phenylheptanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CCC(O)(CC(=O)CC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H34O5Si/c1-24(2,3)31(4,5)30-22-13-11-19(12-14-22)15-16-25(29,18-21(26)17-23(27)28)20-9-7-6-8-10-20/h6-14,29H,15-18H2,1-5H3,(H,27,28) |
| InChIKey | LMXZAEMBZZBNMT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|