C17H27ClO3Si — CID 100965617
1-[tert-butyl(dimethyl)silyl]oxy-5-chloro-4-hydroxy-4-phenylpentan-2-one (PubChem CID 100965617) has the molecular formula C17H27ClO3Si and a molecular weight of 342.94 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-5-chloro-4-hydroxy-4-phenylpentan-2-one.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-5-chloro-4-hydroxy-4-phenylpentan-2-one |
|---|---|
| PubChem CID | 100965617 |
| Molecular Formula | C17H27ClO3Si |
| Molecular Weight | 342.94 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-5-chloro-4-hydroxy-4-phenylpentan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC(=O)CC(O)(CCl)c1ccccc1 |
| InChI | InChI=1S/C17H27ClO3Si/c1-16(2,3)22(4,5)21-12-15(19)11-17(20,13-18)14-9-7-6-8-10-14/h6-10,20H,11-13H2,1-5H3 |
| InChIKey | VFZVOFAKCQEKMY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.94 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|