C17H31NO2Si — CID 59835981
1-amino-5-[tert-butyl(dimethyl)silyl]oxy-3-phenylpentan-3-ol (PubChem CID 59835981) has the molecular formula C17H31NO2Si and a molecular weight of 309.53 g/mol. Its IUPAC name is 1-amino-5-[tert-butyl(dimethyl)silyl]oxy-3-phenylpentan-3-ol.
| Compound Name | 1-amino-5-[tert-butyl(dimethyl)silyl]oxy-3-phenylpentan-3-ol |
|---|---|
| PubChem CID | 59835981 |
| Molecular Formula | C17H31NO2Si |
| Molecular Weight | 309.53 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-amino-5-[tert-butyl(dimethyl)silyl]oxy-3-phenylpentan-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(O)(CCN)c1ccccc1 |
| InChI | InChI=1S/C17H31NO2Si/c1-16(2,3)21(4,5)20-14-12-17(19,11-13-18)15-9-7-6-8-10-15/h6-10,19H,11-14,18H2,1-5H3 |
| InChIKey | PZTZYXBMMHGOJA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|