C37H56O5Si2 — CID 21185148
bis[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-phenylmethanol (PubChem CID 21185148) has the molecular formula C37H56O5Si2 and a molecular weight of 637.02 g/mol. Its IUPAC name is bis[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-phenylmethanol.
| Compound Name | bis[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-phenylmethanol |
|---|---|
| PubChem CID | 21185148 |
| Molecular Formula | C37H56O5Si2 |
| Molecular Weight | 637.02 g/mol |
| Exact Mass | 636.37 |
| IUPAC Name | bis[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-phenylmethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCOc1ccc(C(O)(c2ccccc2)c2ccc(OCCCO[Si](C)(C)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C37H56O5Si2/c1-35(2,3)43(7,8)41-28-14-26-39-33-22-18-31(19-23-33)37(38,30-16-12-11-13-17-30)32-20-24-34(25-21-32)40-27-15-29-42-44(9,10)36(4,5)6/h11-13,16-25,38H,14-15,26-29H2,1-10H3 |
| InChIKey | VAQCFPPLYVOJBA-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.02 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|