C33H50O4Si — CID 155790029
1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-1-(4-decoxyphenyl)prop-2-yn-1-ol (PubChem CID 155790029) has the molecular formula C33H50O4Si and a molecular weight of 538.85 g/mol. Its IUPAC name is 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-1-(4-decoxyphenyl)prop-2-yn-1-ol.
| Compound Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-1-(4-decoxyphenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 155790029 |
| Molecular Formula | C33H50O4Si |
| Molecular Weight | 538.85 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]phenyl]-1-(4-decoxyphenyl)prop-2-yn-1-ol |
| SMILES | C#CC(O)(c1ccc(OCCCCCCCCCC)cc1)c1ccc(OCCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H50O4Si/c1-8-10-11-12-13-14-15-16-25-35-30-21-17-28(18-22-30)33(34,9-2)29-19-23-31(24-20-29)36-26-27-37-38(6,7)32(3,4)5/h2,17-24,34H,8,10-16,25-27H2,1,3-7H3 |
| InChIKey | NHOWQVPHQFDFOM-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.85 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|