C36H56O9Si — CID 164811356
1-[4-[2-[2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-1-(4-propoxyphenyl)prop-2-yn-1-ol (PubChem CID 164811356) has the molecular formula C36H56O9Si and a molecular weight of 660.92 g/mol. Its IUPAC name is 1-[4-[2-[2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-1-(4-propoxyphenyl)prop-2-yn-1-ol.
| Compound Name | 1-[4-[2-[2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-1-(4-propoxyphenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 164811356 |
| Molecular Formula | C36H56O9Si |
| Molecular Weight | 660.92 g/mol |
| Exact Mass | 660.37 |
| IUPAC Name | 1-[4-[2-[2-[2-[2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-1-(4-propoxyphenyl)prop-2-yn-1-ol |
| SMILES | C#CC(O)(c1ccc(OCCC)cc1)c1ccc(OCCOCCOCCOCCOCCOCCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C36H56O9Si/c1-8-18-43-33-14-10-31(11-15-33)36(37,9-2)32-12-16-34(17-13-32)44-29-27-41-25-23-39-21-19-38-20-22-40-24-26-42-28-30-45-46(6,7)35(3,4)5/h2,10-17,37H,8,18-30H2,1,3-7H3 |
| InChIKey | HYMRSNPEWSTROD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.92 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|