C33H56O8Si2 — CID 6421145
trimethyl-[2-[2-[2-[4-[2-[4-[2-[2-(2-trimethylsilyloxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethoxy]ethoxy]silane (PubChem CID 6421145) has the molecular formula C33H56O8Si2 and a molecular weight of 636.97 g/mol. Its IUPAC name is trimethyl-[2-[2-[2-[4-[2-[4-[2-[2-(2-trimethylsilyloxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethoxy]ethoxy]silane.
| Compound Name | trimethyl-[2-[2-[2-[4-[2-[4-[2-[2-(2-trimethylsilyloxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethoxy]ethoxy]silane |
|---|---|
| PubChem CID | 6421145 |
| Molecular Formula | C33H56O8Si2 |
| Molecular Weight | 636.97 g/mol |
| Exact Mass | 636.35 |
| IUPAC Name | trimethyl-[2-[2-[2-[4-[2-[4-[2-[2-(2-trimethylsilyloxyethoxy)ethoxy]ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethoxy]ethoxy]silane |
| SMILES | CC(C)(c1ccc(OCCOCCOCCO[Si](C)(C)C)cc1)c1ccc(OCCOCCOCCO[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C33H56O8Si2/c1-33(2,29-9-13-31(14-10-29)38-25-21-34-17-19-36-23-27-40-42(3,4)5)30-11-15-32(16-12-30)39-26-22-35-18-20-37-24-28-41-43(6,7)8/h9-16H,17-28H2,1-8H3 |
| InChIKey | JHPOYBLQONKAGU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.97 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|