C27H38O4Si — CID 177279564
1-[4-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-1-(4-propoxyphenyl)prop-2-yn-1-ol (PubChem CID 177279564) has the molecular formula C27H38O4Si and a molecular weight of 454.68 g/mol. Its IUPAC name is 1-[4-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-1-(4-propoxyphenyl)prop-2-yn-1-ol.
| Compound Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-1-(4-propoxyphenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 177279564 |
| Molecular Formula | C27H38O4Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-1-(4-propoxyphenyl)prop-2-yn-1-ol |
| SMILES | C#CC(O)(c1ccc(OCCC)cc1)c1ccc(OCC(C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H38O4Si/c1-9-19-29-24-15-11-22(12-16-24)27(28,10-2)23-13-17-25(18-14-23)30-20-21(3)31-32(7,8)26(4,5)6/h2,11-18,21,28H,9,19-20H2,1,3-8H3 |
| InChIKey | XSCBUSJXFNFIEX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|