C24H36O3Si — CID 142544530
4-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]phenyl]phenol (PubChem CID 142544530) has the molecular formula C24H36O3Si and a molecular weight of 400.64 g/mol. Its IUPAC name is 4-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]phenyl]phenol.
| Compound Name | 4-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]phenyl]phenol |
|---|---|
| PubChem CID | 142544530 |
| Molecular Formula | C24H36O3Si |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 4-[4-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]phenyl]phenol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCOc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H36O3Si/c1-24(2,3)28(4,5)27-19-9-7-6-8-18-26-23-16-12-21(13-17-23)20-10-14-22(25)15-11-20/h10-17,25H,6-9,18-19H2,1-5H3 |
| InChIKey | BUYJQFQJJXCSCM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|