C36H55NO2Si2 — CID 139657241
tert-butyl-[4-[5-[4-[7-[tert-butyl(dimethyl)silyl]oxyheptyl]phenyl]-2-pyridinyl]phenoxy]-dimethylsilane (PubChem CID 139657241) has the molecular formula C36H55NO2Si2 and a molecular weight of 590.01 g/mol. Its IUPAC name is tert-butyl-[4-[5-[4-[7-[tert-butyl(dimethyl)silyl]oxyheptyl]phenyl]-2-pyridinyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[5-[4-[7-[tert-butyl(dimethyl)silyl]oxyheptyl]phenyl]-2-pyridinyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 139657241 |
| Molecular Formula | C36H55NO2Si2 |
| Molecular Weight | 590.01 g/mol |
| Exact Mass | 589.38 |
| IUPAC Name | tert-butyl-[4-[5-[4-[7-[tert-butyl(dimethyl)silyl]oxyheptyl]phenyl]-2-pyridinyl]phenoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCCc1ccc(-c2ccc(-c3ccc(O[Si](C)(C)C(C)(C)C)cc3)nc2)cc1 |
| InChI | InChI=1S/C36H55NO2Si2/c1-35(2,3)40(7,8)38-27-15-13-11-12-14-16-29-17-19-30(20-18-29)32-23-26-34(37-28-32)31-21-24-33(25-22-31)39-41(9,10)36(4,5)6/h17-26,28H,11-16,27H2,1-10H3 |
| InChIKey | CWMOFFSVWVEOBR-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.01 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|