C18H33NOSi — CID 175965094
tert-butyl-dimethyl-[4-(6-propan-2-yl-3-pyridinyl)butoxy]silane (PubChem CID 175965094) has the molecular formula C18H33NOSi and a molecular weight of 307.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-(6-propan-2-yl-3-pyridinyl)butoxy]silane.
| Compound Name | tert-butyl-dimethyl-[4-(6-propan-2-yl-3-pyridinyl)butoxy]silane |
|---|---|
| PubChem CID | 175965094 |
| Molecular Formula | C18H33NOSi |
| Molecular Weight | 307.55 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | tert-butyl-dimethyl-[4-(6-propan-2-yl-3-pyridinyl)butoxy]silane |
| SMILES | CC(C)c1ccc(CCCCO[Si](C)(C)C(C)(C)C)cn1 |
| InChI | InChI=1S/C18H33NOSi/c1-15(2)17-12-11-16(14-19-17)10-8-9-13-20-21(6,7)18(3,4)5/h11-12,14-15H,8-10,13H2,1-7H3 |
| InChIKey | OYJSTMNACPPZMB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|