C17H28N2O2Si — CID 176655957
tert-butyl-dimethyl-[3-(1-methylindazol-6-yl)oxypropoxy]silane (PubChem CID 176655957) has the molecular formula C17H28N2O2Si and a molecular weight of 320.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-(1-methylindazol-6-yl)oxypropoxy]silane.
| Compound Name | tert-butyl-dimethyl-[3-(1-methylindazol-6-yl)oxypropoxy]silane |
|---|---|
| PubChem CID | 176655957 |
| Molecular Formula | C17H28N2O2Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | tert-butyl-dimethyl-[3-(1-methylindazol-6-yl)oxypropoxy]silane |
| SMILES | Cn1ncc2ccc(OCCCO[Si](C)(C)C(C)(C)C)cc21 |
| InChI | InChI=1S/C17H28N2O2Si/c1-17(2,3)22(5,6)21-11-7-10-20-15-9-8-14-13-18-19(4)16(14)12-15/h8-9,12-13H,7,10-11H2,1-6H3 |
| InChIKey | JJZSXKHQJWZXAW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|