C31H36BrOPSi — CID 10393091
[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl-triphenylphosphanium bromide (PubChem CID 10393091) has the molecular formula C31H36BrOPSi and a molecular weight of 563.59 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl-triphenylphosphanium bromide.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 10393091 |
| Molecular Formula | C31H36BrOPSi |
| Molecular Weight | 563.59 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl-triphenylphosphanium bromide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C31H36OPSi.BrH/c1-31(2,3)34(4,5)32-27-23-21-26(22-24-27)25-33(28-15-9-6-10-16-28,29-17-11-7-12-18-29)30-19-13-8-14-20-30;/h6-24H,25H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | KNFXYVHYTHGIOI-UHFFFAOYSA-M |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|