C26H34N2OSi — CID 19763310
4-N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-N,4-N-dimethyl-1-N-phenylbenzene-1,4-diamine (PubChem CID 19763310) has the molecular formula C26H34N2OSi and a molecular weight of 418.66 g/mol. Its IUPAC name is 4-N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-N,4-N-dimethyl-1-N-phenylbenzene-1,4-diamine.
| Compound Name | 4-N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-N,4-N-dimethyl-1-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 19763310 |
| Molecular Formula | C26H34N2OSi |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 4-N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-N,4-N-dimethyl-1-N-phenylbenzene-1,4-diamine |
| SMILES | CN(c1ccccc1)c1ccc(N(C)c2ccc(O[Si](C)(C)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H34N2OSi/c1-26(2,3)30(6,7)29-25-19-17-24(18-20-25)28(5)23-15-13-22(14-16-23)27(4)21-11-9-8-10-12-21/h8-20H,1-7H3 |
| InChIKey | DGTGNZPIZWAWEL-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|