About ethene;N-methyl-N-phenylaniline
ethene;N-methyl-N-phenylaniline (PubChem CID 144541479) has the molecular formula C15H17N
and a molecular weight of 211.31 g/mol. Its IUPAC name is ethene;N-methyl-N-phenylaniline.
Molecular Properties
| Compound Name | ethene;N-methyl-N-phenylaniline |
| PubChem CID | 144541479 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | ethene;N-methyl-N-phenylaniline |
| SMILES | C=C.CN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13N.C2H4/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-2/h2-11H,1H3;1-2H2 |
| InChIKey | ZYYOVEFIRVTEEF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;N-methyl-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;N-methyl-N-phenylaniline?
The IUPAC name of ethene;N-methyl-N-phenylaniline (CID 144541479) is ethene;N-methyl-N-phenylaniline.
What is the SMILES notation for ethene;N-methyl-N-phenylaniline?
The canonical SMILES for ethene;N-methyl-N-phenylaniline is C=C.CN(c1ccccc1)c1ccccc1.
What is the InChIKey of ethene;N-methyl-N-phenylaniline?
The InChIKey is ZYYOVEFIRVTEEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.C2H4/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-2/h2-11H,1H3;1-2H2.
What are the key properties of ethene;N-methyl-N-phenylaniline?
ethene;N-methyl-N-phenylaniline has a molecular weight of 211.31 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;N-methyl-N-phenylaniline is sourced from PubChem (CID 144541479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).