C41H40N2 — CID 161221550
N,N-dimethylaniline;N-methyl-N-phenylaniline;naphthalene (PubChem CID 161221550) has the molecular formula C41H40N2 and a molecular weight of 560.79 g/mol. Its IUPAC name is N,N-dimethylaniline;N-methyl-N-phenylaniline;naphthalene.
| Compound Name | N,N-dimethylaniline;N-methyl-N-phenylaniline;naphthalene |
|---|---|
| PubChem CID | 161221550 |
| Molecular Formula | C41H40N2 |
| Molecular Weight | 560.79 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | N,N-dimethylaniline;N-methyl-N-phenylaniline;naphthalene |
| SMILES | CN(C)c1ccccc1.CN(c1ccccc1)c1ccccc1.c1ccc2ccccc2c1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H13N.2C10H8.C8H11N/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;2*1-2-6-10-8-4-3-7-9(10)5-1;1-9(2)8-6-4-3-5-7-8/h2-11H,1H3;2*1-8H;3-7H,1-2H3 |
| InChIKey | UXOPZLKGQGPGNE-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.79 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |