C27H27BN2 — CID 159627771
4-N-(4-diphenylboranylphenyl)-1-N,1-N,4-N-trimethylbenzene-1,4-diamine (PubChem CID 159627771) has the molecular formula C27H27BN2 and a molecular weight of 390.34 g/mol. Its IUPAC name is 4-N-(4-diphenylboranylphenyl)-1-N,1-N,4-N-trimethylbenzene-1,4-diamine.
| Compound Name | 4-N-(4-diphenylboranylphenyl)-1-N,1-N,4-N-trimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 159627771 |
| Molecular Formula | C27H27BN2 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 4-N-(4-diphenylboranylphenyl)-1-N,1-N,4-N-trimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(N(C)c2ccc(B(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H27BN2/c1-29(2)25-18-20-27(21-19-25)30(3)26-16-14-24(15-17-26)28(22-10-6-4-7-11-22)23-12-8-5-9-13-23/h4-21H,1-3H3 |
| InChIKey | VIYADPCJJJMBTC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|