C19H21N — CID 163291837
cyclohexa-1,3-diene;N-methyl-N-phenylaniline (PubChem CID 163291837) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is cyclohexa-1,3-diene;N-methyl-N-phenylaniline.
| Compound Name | cyclohexa-1,3-diene;N-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 163291837 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | cyclohexa-1,3-diene;N-methyl-N-phenylaniline |
| SMILES | C1=CCCC=C1.CN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13N.C6H8/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-2-4-6-5-3-1/h2-11H,1H3;1-4H,5-6H2 |
| InChIKey | UXQGSGXLDOEYPE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |