C27H31N — CID 145203844
1,1'-biphenyl;N-cyclohexa-1,3-dien-1-yl-N-methylaniline;ethane (PubChem CID 145203844) has the molecular formula C27H31N and a molecular weight of 369.55 g/mol. Its IUPAC name is 1,1'-biphenyl;N-cyclohexa-1,3-dien-1-yl-N-methylaniline;ethane.
| Compound Name | 1,1'-biphenyl;N-cyclohexa-1,3-dien-1-yl-N-methylaniline;ethane |
|---|---|
| PubChem CID | 145203844 |
| Molecular Formula | C27H31N |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 1,1'-biphenyl;N-cyclohexa-1,3-dien-1-yl-N-methylaniline;ethane |
| SMILES | CC.CN(C1=CC=CCC1)c1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H15N.C12H10.C2H6/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2/h2-6,8-10H,7,11H2,1H3;1-10H;1-2H3 |
| InChIKey | ZNKXQDGQMYISLP-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |