C22H25N — CID 163765036
4-tert-butyl-N-cyclohexa-1,3-dien-1-yl-N-phenylaniline (PubChem CID 163765036) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is 4-tert-butyl-N-cyclohexa-1,3-dien-1-yl-N-phenylaniline.
| Compound Name | 4-tert-butyl-N-cyclohexa-1,3-dien-1-yl-N-phenylaniline |
|---|---|
| PubChem CID | 163765036 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 4-tert-butyl-N-cyclohexa-1,3-dien-1-yl-N-phenylaniline |
| SMILES | CC(C)(C)c1ccc(N(C2=CC=CCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25N/c1-22(2,3)18-14-16-21(17-15-18)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-8,10-12,14-17H,9,13H2,1-3H3 |
| InChIKey | MBNCVOXGMKOEFU-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |