C36H30N2O2S — CID 170319221
N-cyclohexa-1,3-dien-1-yl-N-phenyl-4-[4-(N-phenylanilino)phenyl]sulfonylaniline (PubChem CID 170319221) has the molecular formula C36H30N2O2S and a molecular weight of 554.72 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-N-phenyl-4-[4-(N-phenylanilino)phenyl]sulfonylaniline.
| Compound Name | N-cyclohexa-1,3-dien-1-yl-N-phenyl-4-[4-(N-phenylanilino)phenyl]sulfonylaniline |
|---|---|
| PubChem CID | 170319221 |
| Molecular Formula | C36H30N2O2S |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-N-phenyl-4-[4-(N-phenylanilino)phenyl]sulfonylaniline |
| SMILES | O=S(=O)(c1ccc(N(C2=CC=CCC2)c2ccccc2)cc1)c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H30N2O2S/c39-41(40,35-25-21-33(22-26-35)37(29-13-5-1-6-14-29)30-15-7-2-8-16-30)36-27-23-34(24-28-36)38(31-17-9-3-10-18-31)32-19-11-4-12-20-32/h1-11,13-19,21-28H,12,20H2 |
| InChIKey | YSPVIMHGGRGSDL-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |