C52H40N2O2S — CID 102299060
N,N-diphenyl-4-[(E)-2-[4-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]sulfonylphenyl]ethenyl]aniline (PubChem CID 102299060) has the molecular formula C52H40N2O2S and a molecular weight of 756.97 g/mol. Its IUPAC name is N,N-diphenyl-4-[(E)-2-[4-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]sulfonylphenyl]ethenyl]aniline.
| Compound Name | N,N-diphenyl-4-[(E)-2-[4-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]sulfonylphenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 102299060 |
| Molecular Formula | C52H40N2O2S |
| Molecular Weight | 756.97 g/mol |
| Exact Mass | 756.28 |
| IUPAC Name | N,N-diphenyl-4-[(E)-2-[4-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]sulfonylphenyl]ethenyl]aniline |
| SMILES | O=S(=O)(c1ccc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1)c1ccc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C52H40N2O2S/c55-57(56,51-37-29-43(30-38-51)23-21-41-25-33-49(34-26-41)53(45-13-5-1-6-14-45)46-15-7-2-8-16-46)52-39-31-44(32-40-52)24-22-42-27-35-50(36-28-42)54(47-17-9-3-10-18-47)48-19-11-4-12-20-48/h1-40H/b23-21+,24-22+ |
| InChIKey | WQSQJHZTRITEQG-MBALSZOMSA-N |
| XLogP | 13.80 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.97 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|