C57H45N7O6S3 — CID 177485255
4-[(E)-[[4-(benzenesulfonyl)phenyl]hydrazinylidene]methyl]-N,N-bis[4-[(E)-[[4-(benzenesulfonyl)phenyl]hydrazinylidene]methyl]phenyl]aniline (PubChem CID 177485255) has the molecular formula C57H45N7O6S3 and a molecular weight of 1020.23 g/mol. Its IUPAC name is 4-[(E)-[[4-(benzenesulfonyl)phenyl]hydrazinylidene]methyl]-N,N-bis[4-[(E)-[[4-(benzenesulfonyl)phenyl]hydrazinylidene]methyl]phenyl]aniline.
| Compound Name | 4-[(E)-[[4-(benzenesulfonyl)phenyl]hydrazinylidene]methyl]-N,N-bis[4-[(E)-[[4-(benzenesulfonyl)phenyl]hydrazinylidene]methyl]phenyl]aniline |
|---|---|
| PubChem CID | 177485255 |
| Molecular Formula | C57H45N7O6S3 |
| Molecular Weight | 1020.23 g/mol |
| Exact Mass | 1019.26 |
| IUPAC Name | 4-[(E)-[[4-(benzenesulfonyl)phenyl]hydrazinylidene]methyl]-N,N-bis[4-[(E)-[[4-(benzenesulfonyl)phenyl]hydrazinylidene]methyl]phenyl]aniline |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(N/N=C/c2ccc(N(c3ccc(/C=N/Nc4ccc(S(=O)(=O)c5ccccc5)cc4)cc3)c3ccc(/C=N/Nc4ccc(S(=O)(=O)c5ccccc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C57H45N7O6S3/c65-71(66,52-10-4-1-5-11-52)55-34-22-46(23-35-55)61-58-40-43-16-28-49(29-17-43)64(50-30-18-44(19-31-50)41-59-62-47-24-36-56(37-25-47)72(67,68)53-12-6-2-7-13-53)51-32-20-45(21-33-51)42-60-63-48-26-38-57(39-27-48)73(69,70)54-14-8-3-9-15-54/h1-42,61-63H/b58-40+,59-41+,60-42+ |
| InChIKey | OFIZUWMBOXBVJM-BTFKFKKVSA-N |
| XLogP | 11.99 |
| TPSA | 178.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.23 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|