C17H21N3O2S — CID 5335146
N-[(E)-[4-(diethylamino)phenyl]methylideneamino]benzenesulfonamide (PubChem CID 5335146) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-[(E)-[4-(diethylamino)phenyl]methylideneamino]benzenesulfonamide.
| Compound Name | N-[(E)-[4-(diethylamino)phenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 5335146 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[(E)-[4-(diethylamino)phenyl]methylideneamino]benzenesulfonamide |
| SMILES | CCN(CC)c1ccc(/C=N/NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H21N3O2S/c1-3-20(4-2)16-12-10-15(11-13-16)14-18-19-23(21,22)17-8-6-5-7-9-17/h5-14,19H,3-4H2,1-2H3/b18-14+ |
| InChIKey | UWHPKEFYWVNAPO-NBVRZTHBSA-N |
| XLogP | 2.85 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|