C28H26N4O4S2 — CID 125114108
N-[(Z)-benzylideneamino]-4-[2-[4-[[(Z)-benzylideneamino]sulfamoyl]phenyl]ethyl]benzenesulfonamide (PubChem CID 125114108) has the molecular formula C28H26N4O4S2 and a molecular weight of 546.67 g/mol. Its IUPAC name is N-[(Z)-benzylideneamino]-4-[2-[4-[[(Z)-benzylideneamino]sulfamoyl]phenyl]ethyl]benzenesulfonamide.
| Compound Name | N-[(Z)-benzylideneamino]-4-[2-[4-[[(Z)-benzylideneamino]sulfamoyl]phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 125114108 |
| Molecular Formula | C28H26N4O4S2 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | N-[(Z)-benzylideneamino]-4-[2-[4-[[(Z)-benzylideneamino]sulfamoyl]phenyl]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(N/N=C\c1ccccc1)c1ccc(CCc2ccc(S(=O)(=O)N/N=C\c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H26N4O4S2/c33-37(34,31-29-21-25-7-3-1-4-8-25)27-17-13-23(14-18-27)11-12-24-15-19-28(20-16-24)38(35,36)32-30-22-26-9-5-2-6-10-26/h1-10,13-22,31-32H,11-12H2/b29-21-,30-22- |
| InChIKey | LFAKXDMSQUFACY-DHQAUHHZSA-N |
| XLogP | 4.10 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|