C14H15N3O2S — CID 27484544
4-ethyl-N-(pyridin-3-ylmethylideneamino)benzenesulfonamide (PubChem CID 27484544) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-ethyl-N-(pyridin-3-ylmethylideneamino)benzenesulfonamide.
| Compound Name | 4-ethyl-N-(pyridin-3-ylmethylideneamino)benzenesulfonamide |
|---|---|
| PubChem CID | 27484544 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-ethyl-N-(pyridin-3-ylmethylideneamino)benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NN=Cc2cccnc2)cc1 |
| InChI | InChI=1S/C14H15N3O2S/c1-2-12-5-7-14(8-6-12)20(18,19)17-16-11-13-4-3-9-15-10-13/h3-11,17H,2H2,1H3 |
| InChIKey | USPARWHIVBVPAN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|