C17H16N4S — CID 45124174
4-(4-ethylphenyl)-N-[(E)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-amine (PubChem CID 45124174) has the molecular formula C17H16N4S and a molecular weight of 308.41 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-N-[(E)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-ethylphenyl)-N-[(E)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 45124174 |
| Molecular Formula | C17H16N4S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 4-(4-ethylphenyl)-N-[(E)-pyridin-3-ylmethylideneamino]-1,3-thiazol-2-amine |
| SMILES | CCc1ccc(-c2csc(N/N=C/c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C17H16N4S/c1-2-13-5-7-15(8-6-13)16-12-22-17(20-16)21-19-11-14-4-3-9-18-10-14/h3-12H,2H2,1H3,(H,20,21)/b19-11+ |
| InChIKey | MQTFYPZUOUXXNU-YBFXNURJSA-N |
| XLogP | 4.21 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|